About methyl (3S)-6,10-dithia-2-azaspiro[4.5]decane-3-carboxylate
methyl (3S)-6,10-dithia-2-azaspiro[4.5]decane-3-carboxylate (PubChem CID 14036263) has the molecular formula C9H15NO2S2
and a molecular weight of 233.36 g/mol. Its IUPAC name is methyl (3S)-6,10-dithia-2-azaspiro[4.5]decane-3-carboxylate.
Molecular Properties
| Compound Name | methyl (3S)-6,10-dithia-2-azaspiro[4.5]decane-3-carboxylate |
| PubChem CID | 14036263 |
| Molecular Formula | C9H15NO2S2 |
| Molecular Weight | 233.36 g/mol |
| Exact Mass | 233.05 |
| IUPAC Name | methyl (3S)-6,10-dithia-2-azaspiro[4.5]decane-3-carboxylate |
| SMILES | COC(=O)[C@@H]1CC2(CN1)SCCCS2 |
| InChI | InChI=1S/C9H15NO2S2/c1-12-8(11)7-5-9(6-10-7)13-3-2-4-14-9/h7,10H,2-6H2,1H3/t7-/m0/s1 |
| InChIKey | MRYQJKWTWPKFNB-ZETCQYMHSA-N |
| XLogP | 1.09 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 233.36 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze methyl (3S)-6,10-dithia-2-azaspiro[4.5]decane-3-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl (3S)-6,10-dithia-2-azaspiro[4.5]decane-3-carboxylate?
The IUPAC name of methyl (3S)-6,10-dithia-2-azaspiro[4.5]decane-3-carboxylate (CID 14036263) is methyl (3S)-6,10-dithia-2-azaspiro[4.5]decane-3-carboxylate.
What is the SMILES notation for methyl (3S)-6,10-dithia-2-azaspiro[4.5]decane-3-carboxylate?
The canonical SMILES for methyl (3S)-6,10-dithia-2-azaspiro[4.5]decane-3-carboxylate is COC(=O)[C@@H]1CC2(CN1)SCCCS2.
What is the InChIKey of methyl (3S)-6,10-dithia-2-azaspiro[4.5]decane-3-carboxylate?
The InChIKey is MRYQJKWTWPKFNB-ZETCQYMHSA-N. The full InChI is InChI=1S/C9H15NO2S2/c1-12-8(11)7-5-9(6-10-7)13-3-2-4-14-9/h7,10H,2-6H2,1H3/t7-/m0/s1.
What are the key properties of methyl (3S)-6,10-dithia-2-azaspiro[4.5]decane-3-carboxylate?
methyl (3S)-6,10-dithia-2-azaspiro[4.5]decane-3-carboxylate has a molecular weight of 233.36 g/mol, XLogP of 1.09, 1 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for methyl (3S)-6,10-dithia-2-azaspiro[4.5]decane-3-carboxylate is sourced from PubChem (CID 14036263), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).