C12H13NO4S — CID 14038143
methyl 5-oxo-1-(2-thiophen-2-ylacetyl)pyrrolidine-2-carboxylate (PubChem CID 14038143) has the molecular formula C12H13NO4S and a molecular weight of 267.31 g/mol. Its IUPAC name is methyl 5-oxo-1-(2-thiophen-2-ylacetyl)pyrrolidine-2-carboxylate.
| Compound Name | methyl 5-oxo-1-(2-thiophen-2-ylacetyl)pyrrolidine-2-carboxylate |
|---|---|
| PubChem CID | 14038143 |
| Molecular Formula | C12H13NO4S |
| Molecular Weight | 267.31 g/mol |
| Exact Mass | 267.06 |
| IUPAC Name | methyl 5-oxo-1-(2-thiophen-2-ylacetyl)pyrrolidine-2-carboxylate |
| SMILES | COC(=O)C1CCC(=O)N1C(=O)Cc1cccs1 |
| InChI | InChI=1S/C12H13NO4S/c1-17-12(16)9-4-5-10(14)13(9)11(15)7-8-3-2-6-18-8/h2-3,6,9H,4-5,7H2,1H3 |
| InChIKey | MGHYVVUIIWVTKQ-UHFFFAOYSA-N |
| XLogP | 0.98 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.31 |
| LogP ≤ 5 | 0.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |