C16H20N2O2 — CID 14038171
4-methoxy-8-methyl-8,16-diazatetracyclo[7.4.3.01,9.02,7]hexadeca-2(7),3,5-trien-15-one (PubChem CID 14038171) has the molecular formula C16H20N2O2 and a molecular weight of 272.35 g/mol. Its IUPAC name is 4-methoxy-8-methyl-8,16-diazatetracyclo[7.4.3.01,9.02,7]hexadeca-2(7),3,5-trien-15-one.
| Compound Name | 4-methoxy-8-methyl-8,16-diazatetracyclo[7.4.3.01,9.02,7]hexadeca-2(7),3,5-trien-15-one |
|---|---|
| PubChem CID | 14038171 |
| Molecular Formula | C16H20N2O2 |
| Molecular Weight | 272.35 g/mol |
| Exact Mass | 272.15 |
| IUPAC Name | 4-methoxy-8-methyl-8,16-diazatetracyclo[7.4.3.01,9.02,7]hexadeca-2(7),3,5-trien-15-one |
| SMILES | COc1ccc2c(c1)C13CCCCC1(NC(=O)C3)N2C |
| InChI | InChI=1S/C16H20N2O2/c1-18-13-6-5-11(20-2)9-12(13)15-7-3-4-8-16(15,18)17-14(19)10-15/h5-6,9H,3-4,7-8,10H2,1-2H3,(H,17,19) |
| InChIKey | IUFFNSKMDFRGJU-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.35 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|