C12H18O3 — CID 14038433
3-(methoxymethoxymethyl)-4-prop-1-en-2-ylcyclohex-2-en-1-one (PubChem CID 14038433) has the molecular formula C12H18O3 and a molecular weight of 210.27 g/mol. Its IUPAC name is 3-(methoxymethoxymethyl)-4-prop-1-en-2-ylcyclohex-2-en-1-one.
| Compound Name | 3-(methoxymethoxymethyl)-4-prop-1-en-2-ylcyclohex-2-en-1-one |
|---|---|
| PubChem CID | 14038433 |
| Molecular Formula | C12H18O3 |
| Molecular Weight | 210.27 g/mol |
| Exact Mass | 210.13 |
| IUPAC Name | 3-(methoxymethoxymethyl)-4-prop-1-en-2-ylcyclohex-2-en-1-one |
| SMILES | C=C(C)C1CCC(=O)C=C1COCOC |
| InChI | InChI=1S/C12H18O3/c1-9(2)12-5-4-11(13)6-10(12)7-15-8-14-3/h6,12H,1,4-5,7-8H2,2-3H3 |
| InChIKey | XUSOAMIBPLCZGO-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.27 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|