About methyl (2S)-2-aminohexanoate;hydrochloride
methyl (2S)-2-aminohexanoate;hydrochloride (PubChem CID 14039065) has the molecular formula C7H16ClNO2
and a molecular weight of 181.66 g/mol. Its IUPAC name is methyl (2S)-2-aminohexanoate;hydrochloride.
Molecular Properties
| Compound Name | methyl (2S)-2-aminohexanoate;hydrochloride |
| PubChem CID | 14039065 |
| Molecular Formula | C7H16ClNO2 |
| Molecular Weight | 181.66 g/mol |
| Exact Mass | 181.09 |
| IUPAC Name | methyl (2S)-2-aminohexanoate;hydrochloride |
| SMILES | CCCC[C@H](N)C(=O)OC.Cl |
| InChI | InChI=1S/C7H15NO2.ClH/c1-3-4-5-6(8)7(9)10-2;/h6H,3-5,8H2,1-2H3;1H/t6-;/m0./s1 |
| InChIKey | FMMOVZRXLNVNBI-RGMNGODLSA-N |
| XLogP | 1.10 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 181.66 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze methyl (2S)-2-aminohexanoate;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl (2S)-2-aminohexanoate;hydrochloride?
The IUPAC name of methyl (2S)-2-aminohexanoate;hydrochloride (CID 14039065) is methyl (2S)-2-aminohexanoate;hydrochloride.
What is the SMILES notation for methyl (2S)-2-aminohexanoate;hydrochloride?
The canonical SMILES for methyl (2S)-2-aminohexanoate;hydrochloride is CCCC[C@H](N)C(=O)OC.Cl.
What is the InChIKey of methyl (2S)-2-aminohexanoate;hydrochloride?
The InChIKey is FMMOVZRXLNVNBI-RGMNGODLSA-N. The full InChI is InChI=1S/C7H15NO2.ClH/c1-3-4-5-6(8)7(9)10-2;/h6H,3-5,8H2,1-2H3;1H/t6-;/m0./s1.
What are the key properties of methyl (2S)-2-aminohexanoate;hydrochloride?
methyl (2S)-2-aminohexanoate;hydrochloride has a molecular weight of 181.66 g/mol, XLogP of 1.10, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for methyl (2S)-2-aminohexanoate;hydrochloride is sourced from PubChem (CID 14039065), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).