C17H28O3 — CID 14039070
(4E,8E)-4,8-dimethyl-10-(oxan-2-yloxy)deca-4,8-dienal (PubChem CID 14039070) has the molecular formula C17H28O3 and a molecular weight of 280.41 g/mol. Its IUPAC name is (4E,8E)-4,8-dimethyl-10-(oxan-2-yloxy)deca-4,8-dienal.
| Compound Name | (4E,8E)-4,8-dimethyl-10-(oxan-2-yloxy)deca-4,8-dienal |
|---|---|
| PubChem CID | 14039070 |
| Molecular Formula | C17H28O3 |
| Molecular Weight | 280.41 g/mol |
| Exact Mass | 280.20 |
| IUPAC Name | (4E,8E)-4,8-dimethyl-10-(oxan-2-yloxy)deca-4,8-dienal |
| SMILES | C/C(=C\CC/C(C)=C/COC1CCCCO1)CCC=O |
| InChI | InChI=1S/C17H28O3/c1-15(9-6-12-18)7-5-8-16(2)11-14-20-17-10-3-4-13-19-17/h7,11-12,17H,3-6,8-10,13-14H2,1-2H3/b15-7+,16-11+ |
| InChIKey | HIWOITDVOXMOTH-MNBXHXLRSA-N |
| XLogP | 4.18 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.41 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|