C18H30O2 — CID 14039501
(5E,9E)-12-(3,3-dimethyloxiran-2-yl)-6,10-dimethyldodeca-5,9-dien-2-one (PubChem CID 14039501) has the molecular formula C18H30O2 and a molecular weight of 278.44 g/mol. Its IUPAC name is (5E,9E)-12-(3,3-dimethyloxiran-2-yl)-6,10-dimethyldodeca-5,9-dien-2-one.
| Compound Name | (5E,9E)-12-(3,3-dimethyloxiran-2-yl)-6,10-dimethyldodeca-5,9-dien-2-one |
|---|---|
| PubChem CID | 14039501 |
| Molecular Formula | C18H30O2 |
| Molecular Weight | 278.44 g/mol |
| Exact Mass | 278.22 |
| IUPAC Name | (5E,9E)-12-(3,3-dimethyloxiran-2-yl)-6,10-dimethyldodeca-5,9-dien-2-one |
| SMILES | CC(=O)CC/C=C(\C)CC/C=C(\C)CCC1OC1(C)C |
| InChI | InChI=1S/C18H30O2/c1-14(10-7-11-16(3)19)8-6-9-15(2)12-13-17-18(4,5)20-17/h9-10,17H,6-8,11-13H2,1-5H3/b14-10+,15-9+ |
| InChIKey | VZUCBUQOWZRZJJ-WEIBIQTGSA-N |
| XLogP | 4.99 |
| TPSA | 29.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.44 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|