About 4-[3-[(3E)-4,8-dimethylnona-3,7-dienyl]-3-methyloxiran-2-yl]butan-2-one
4-[3-[(3E)-4,8-dimethylnona-3,7-dienyl]-3-methyloxiran-2-yl]butan-2-one (PubChem CID 14039502) has the molecular formula C18H30O2
and a molecular weight of 278.44 g/mol. Its IUPAC name is 4-[3-[(3E)-4,8-dimethylnona-3,7-dienyl]-3-methyloxiran-2-yl]butan-2-one.
Molecular Properties
| Compound Name | 4-[3-[(3E)-4,8-dimethylnona-3,7-dienyl]-3-methyloxiran-2-yl]butan-2-one |
| PubChem CID | 14039502 |
| Molecular Formula | C18H30O2 |
| Molecular Weight | 278.44 g/mol |
| Exact Mass | 278.22 |
| IUPAC Name | 4-[3-[(3E)-4,8-dimethylnona-3,7-dienyl]-3-methyloxiran-2-yl]butan-2-one |
| SMILES | CC(=O)CCC1OC1(C)CC/C=C(\C)CCC=C(C)C |
| InChI | InChI=1S/C18H30O2/c1-14(2)8-6-9-15(3)10-7-13-18(5)17(20-18)12-11-16(4)19/h8,10,17H,6-7,9,11-13H2,1-5H3/b15-10+ |
| InChIKey | YZNVJVWNDZBBBA-XNTDXEJSSA-N |
| XLogP | 4.99 |
| TPSA | 29.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 278.44 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|
Analyze 4-[3-[(3E)-4,8-dimethylnona-3,7-dienyl]-3-methyloxiran-2-yl]butan-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[3-[(3E)-4,8-dimethylnona-3,7-dienyl]-3-methyloxiran-2-yl]butan-2-one?
The IUPAC name of 4-[3-[(3E)-4,8-dimethylnona-3,7-dienyl]-3-methyloxiran-2-yl]butan-2-one (CID 14039502) is 4-[3-[(3E)-4,8-dimethylnona-3,7-dienyl]-3-methyloxiran-2-yl]butan-2-one.
What is the SMILES notation for 4-[3-[(3E)-4,8-dimethylnona-3,7-dienyl]-3-methyloxiran-2-yl]butan-2-one?
The canonical SMILES for 4-[3-[(3E)-4,8-dimethylnona-3,7-dienyl]-3-methyloxiran-2-yl]butan-2-one is CC(=O)CCC1OC1(C)CC/C=C(\C)CCC=C(C)C.
What is the InChIKey of 4-[3-[(3E)-4,8-dimethylnona-3,7-dienyl]-3-methyloxiran-2-yl]butan-2-one?
The InChIKey is YZNVJVWNDZBBBA-XNTDXEJSSA-N. The full InChI is InChI=1S/C18H30O2/c1-14(2)8-6-9-15(3)10-7-13-18(5)17(20-18)12-11-16(4)19/h8,10,17H,6-7,9,11-13H2,1-5H3/b15-10+.
What are the key properties of 4-[3-[(3E)-4,8-dimethylnona-3,7-dienyl]-3-methyloxiran-2-yl]butan-2-one?
4-[3-[(3E)-4,8-dimethylnona-3,7-dienyl]-3-methyloxiran-2-yl]butan-2-one has a molecular weight of 278.44 g/mol, XLogP of 4.99, 9 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[3-[(3E)-4,8-dimethylnona-3,7-dienyl]-3-methyloxiran-2-yl]butan-2-one is sourced from PubChem (CID 14039502), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).