C19H34O3 — CID 14039504
(2R,5E)-2-[(2S,5R)-5-methoxy-5-methyloxolan-2-yl]-6,10-dimethylundeca-5,9-dien-2-ol (PubChem CID 14039504) has the molecular formula C19H34O3 and a molecular weight of 310.48 g/mol. Its IUPAC name is (2R,5E)-2-[(2S,5R)-5-methoxy-5-methyloxolan-2-yl]-6,10-dimethylundeca-5,9-dien-2-ol.
| Compound Name | (2R,5E)-2-[(2S,5R)-5-methoxy-5-methyloxolan-2-yl]-6,10-dimethylundeca-5,9-dien-2-ol |
|---|---|
| PubChem CID | 14039504 |
| Molecular Formula | C19H34O3 |
| Molecular Weight | 310.48 g/mol |
| Exact Mass | 310.25 |
| IUPAC Name | (2R,5E)-2-[(2S,5R)-5-methoxy-5-methyloxolan-2-yl]-6,10-dimethylundeca-5,9-dien-2-ol |
| SMILES | CO[C@@]1(C)CC[C@@H]([C@](C)(O)CC/C=C(\C)CCC=C(C)C)O1 |
| InChI | InChI=1S/C19H34O3/c1-15(2)9-7-10-16(3)11-8-13-18(4,20)17-12-14-19(5,21-6)22-17/h9,11,17,20H,7-8,10,12-14H2,1-6H3/b16-11+/t17-,18+,19+/m0/s1 |
| InChIKey | WVIPNFACEKDMDZ-UEUBPVBGSA-N |
| XLogP | 4.75 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.48 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|