C7H11NO3S — CID 14039527
(3S)-2,2-dimethyl-5-oxothiomorpholine-3-carboxylic acid (PubChem CID 14039527) has the molecular formula C7H11NO3S and a molecular weight of 189.24 g/mol. Its IUPAC name is (3S)-2,2-dimethyl-5-oxothiomorpholine-3-carboxylic acid.
| Compound Name | (3S)-2,2-dimethyl-5-oxothiomorpholine-3-carboxylic acid |
|---|---|
| PubChem CID | 14039527 |
| Molecular Formula | C7H11NO3S |
| Molecular Weight | 189.24 g/mol |
| Exact Mass | 189.05 |
| IUPAC Name | (3S)-2,2-dimethyl-5-oxothiomorpholine-3-carboxylic acid |
| SMILES | CC1(C)SCC(=O)N[C@H]1C(=O)O |
| InChI | InChI=1S/C7H11NO3S/c1-7(2)5(6(10)11)8-4(9)3-12-7/h5H,3H2,1-2H3,(H,8,9)(H,10,11)/t5-/m0/s1 |
| InChIKey | BWBSSMBCOJPCKE-YFKPBYRVSA-N |
| XLogP | 0.08 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 189.24 |
| LogP ≤ 5 | 0.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |