About 1-methoxybicyclo[4.2.2]deca-7,9-diene
1-methoxybicyclo[4.2.2]deca-7,9-diene (PubChem CID 14040623) has the molecular formula C11H16O
and a molecular weight of 164.25 g/mol. Its IUPAC name is 1-methoxybicyclo[4.2.2]deca-7,9-diene.
Molecular Properties
| Compound Name | 1-methoxybicyclo[4.2.2]deca-7,9-diene |
| PubChem CID | 14040623 |
| Molecular Formula | C11H16O |
| Molecular Weight | 164.25 g/mol |
| Exact Mass | 164.12 |
| IUPAC Name | 1-methoxybicyclo[4.2.2]deca-7,9-diene |
| SMILES | COC12C=CC(C=C1)CCCC2 |
| InChI | InChI=1S/C11H16O/c1-12-11-7-3-2-4-10(5-8-11)6-9-11/h5-6,8-10H,2-4,7H2,1H3 |
| InChIKey | MMOTZLBUFLTWCP-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 164.25 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 1-methoxybicyclo[4.2.2]deca-7,9-diene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-methoxybicyclo[4.2.2]deca-7,9-diene?
The IUPAC name of 1-methoxybicyclo[4.2.2]deca-7,9-diene (CID 14040623) is 1-methoxybicyclo[4.2.2]deca-7,9-diene.
What is the SMILES notation for 1-methoxybicyclo[4.2.2]deca-7,9-diene?
The canonical SMILES for 1-methoxybicyclo[4.2.2]deca-7,9-diene is COC12C=CC(C=C1)CCCC2.
What is the InChIKey of 1-methoxybicyclo[4.2.2]deca-7,9-diene?
The InChIKey is MMOTZLBUFLTWCP-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H16O/c1-12-11-7-3-2-4-10(5-8-11)6-9-11/h5-6,8-10H,2-4,7H2,1H3.
What are the key properties of 1-methoxybicyclo[4.2.2]deca-7,9-diene?
1-methoxybicyclo[4.2.2]deca-7,9-diene has a molecular weight of 164.25 g/mol, XLogP of 2.69, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-methoxybicyclo[4.2.2]deca-7,9-diene is sourced from PubChem (CID 14040623), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).