About 1-propan-2-yloxybicyclo[4.2.2]deca-7,9-diene
1-propan-2-yloxybicyclo[4.2.2]deca-7,9-diene (PubChem CID 14040625) has the molecular formula C13H20O
and a molecular weight of 192.30 g/mol. Its IUPAC name is 1-propan-2-yloxybicyclo[4.2.2]deca-7,9-diene.
Molecular Properties
| Compound Name | 1-propan-2-yloxybicyclo[4.2.2]deca-7,9-diene |
| PubChem CID | 14040625 |
| Molecular Formula | C13H20O |
| Molecular Weight | 192.30 g/mol |
| Exact Mass | 192.15 |
| IUPAC Name | 1-propan-2-yloxybicyclo[4.2.2]deca-7,9-diene |
| SMILES | CC(C)OC12C=CC(C=C1)CCCC2 |
| InChI | InChI=1S/C13H20O/c1-11(2)14-13-8-4-3-5-12(6-9-13)7-10-13/h6-7,9-12H,3-5,8H2,1-2H3 |
| InChIKey | JAVWIIXSXSXNLM-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 192.30 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 1-propan-2-yloxybicyclo[4.2.2]deca-7,9-diene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-propan-2-yloxybicyclo[4.2.2]deca-7,9-diene?
The IUPAC name of 1-propan-2-yloxybicyclo[4.2.2]deca-7,9-diene (CID 14040625) is 1-propan-2-yloxybicyclo[4.2.2]deca-7,9-diene.
What is the SMILES notation for 1-propan-2-yloxybicyclo[4.2.2]deca-7,9-diene?
The canonical SMILES for 1-propan-2-yloxybicyclo[4.2.2]deca-7,9-diene is CC(C)OC12C=CC(C=C1)CCCC2.
What is the InChIKey of 1-propan-2-yloxybicyclo[4.2.2]deca-7,9-diene?
The InChIKey is JAVWIIXSXSXNLM-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H20O/c1-11(2)14-13-8-4-3-5-12(6-9-13)7-10-13/h6-7,9-12H,3-5,8H2,1-2H3.
What are the key properties of 1-propan-2-yloxybicyclo[4.2.2]deca-7,9-diene?
1-propan-2-yloxybicyclo[4.2.2]deca-7,9-diene has a molecular weight of 192.30 g/mol, XLogP of 3.47, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-propan-2-yloxybicyclo[4.2.2]deca-7,9-diene is sourced from PubChem (CID 14040625), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).