C16H20N4O2 — CID 14042143
methyl 3-amino-5-(diethylamino)-6-phenylpyrazine-2-carboxylate (PubChem CID 14042143) has the molecular formula C16H20N4O2 and a molecular weight of 300.36 g/mol. Its IUPAC name is methyl 3-amino-5-(diethylamino)-6-phenylpyrazine-2-carboxylate.
| Compound Name | methyl 3-amino-5-(diethylamino)-6-phenylpyrazine-2-carboxylate |
|---|---|
| PubChem CID | 14042143 |
| Molecular Formula | C16H20N4O2 |
| Molecular Weight | 300.36 g/mol |
| Exact Mass | 300.16 |
| IUPAC Name | methyl 3-amino-5-(diethylamino)-6-phenylpyrazine-2-carboxylate |
| SMILES | CCN(CC)c1nc(N)c(C(=O)OC)nc1-c1ccccc1 |
| InChI | InChI=1S/C16H20N4O2/c1-4-20(5-2)15-12(11-9-7-6-8-10-11)18-13(14(17)19-15)16(21)22-3/h6-10H,4-5H2,1-3H3,(H2,17,19) |
| InChIKey | UAMKATFSVBYBCK-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 81.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.36 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |