C18H14N4O — CID 14042738
7,8-diphenyl-6,7-dihydropyrimido[4,5-c]pyridazin-5-one (PubChem CID 14042738) has the molecular formula C18H14N4O and a molecular weight of 302.34 g/mol. Its IUPAC name is 7,8-diphenyl-6,7-dihydropyrimido[4,5-c]pyridazin-5-one.
| Compound Name | 7,8-diphenyl-6,7-dihydropyrimido[4,5-c]pyridazin-5-one |
|---|---|
| PubChem CID | 14042738 |
| Molecular Formula | C18H14N4O |
| Molecular Weight | 302.34 g/mol |
| Exact Mass | 302.12 |
| IUPAC Name | 7,8-diphenyl-6,7-dihydropyrimido[4,5-c]pyridazin-5-one |
| SMILES | O=C1NC(c2ccccc2)N(c2ccccc2)c2nnccc21 |
| InChI | InChI=1S/C18H14N4O/c23-18-15-11-12-19-21-17(15)22(14-9-5-2-6-10-14)16(20-18)13-7-3-1-4-8-13/h1-12,16H,(H,20,23) |
| InChIKey | UZDWJBZLZFXQEA-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 58.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.34 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |