About 2,6-dibromo-4-ethylaniline
2,6-dibromo-4-ethylaniline (PubChem CID 14043928) has the molecular formula C8H9Br2N
and a molecular weight of 278.98 g/mol. Its IUPAC name is 2,6-dibromo-4-ethylaniline.
Molecular Properties
| Compound Name | 2,6-dibromo-4-ethylaniline |
| PubChem CID | 14043928 |
| Molecular Formula | C8H9Br2N |
| Molecular Weight | 278.98 g/mol |
| Exact Mass | 276.91 |
| IUPAC Name | 2,6-dibromo-4-ethylaniline |
| SMILES | CCc1cc(Br)c(N)c(Br)c1 |
| InChI | InChI=1S/C8H9Br2N/c1-2-5-3-6(9)8(11)7(10)4-5/h3-4H,2,11H2,1H3 |
| InChIKey | CLDKMLUAQWPSSJ-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 278.98 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 2,6-dibromo-4-ethylaniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,6-dibromo-4-ethylaniline?
The IUPAC name of 2,6-dibromo-4-ethylaniline (CID 14043928) is 2,6-dibromo-4-ethylaniline.
What is the SMILES notation for 2,6-dibromo-4-ethylaniline?
The canonical SMILES for 2,6-dibromo-4-ethylaniline is CCc1cc(Br)c(N)c(Br)c1.
What is the InChIKey of 2,6-dibromo-4-ethylaniline?
The InChIKey is CLDKMLUAQWPSSJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H9Br2N/c1-2-5-3-6(9)8(11)7(10)4-5/h3-4H,2,11H2,1H3.
What are the key properties of 2,6-dibromo-4-ethylaniline?
2,6-dibromo-4-ethylaniline has a molecular weight of 278.98 g/mol, XLogP of 3.36, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2,6-dibromo-4-ethylaniline is sourced from PubChem (CID 14043928), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).