About 5,6-difluoro-5,6-bis(trifluoromethyl)-7-oxabicyclo[2.2.1]hept-2-ene
5,6-difluoro-5,6-bis(trifluoromethyl)-7-oxabicyclo[2.2.1]hept-2-ene (PubChem CID 14043961) has the molecular formula C8H4F8O
and a molecular weight of 268.10 g/mol. Its IUPAC name is 5,6-difluoro-5,6-bis(trifluoromethyl)-7-oxabicyclo[2.2.1]hept-2-ene.
Molecular Properties
| Compound Name | 5,6-difluoro-5,6-bis(trifluoromethyl)-7-oxabicyclo[2.2.1]hept-2-ene |
| PubChem CID | 14043961 |
| Molecular Formula | C8H4F8O |
| Molecular Weight | 268.10 g/mol |
| Exact Mass | 268.01 |
| IUPAC Name | 5,6-difluoro-5,6-bis(trifluoromethyl)-7-oxabicyclo[2.2.1]hept-2-ene |
| SMILES | FC(F)(F)C1(F)C2C=CC(O2)C1(F)C(F)(F)F |
| InChI | InChI=1S/C8H4F8O/c9-5(7(11,12)13)3-1-2-4(17-3)6(5,10)8(14,15)16/h1-4H |
| InChIKey | KGWCPMLZTYVDQI-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 268.10 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 5,6-difluoro-5,6-bis(trifluoromethyl)-7-oxabicyclo[2.2.1]hept-2-ene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5,6-difluoro-5,6-bis(trifluoromethyl)-7-oxabicyclo[2.2.1]hept-2-ene?
The IUPAC name of 5,6-difluoro-5,6-bis(trifluoromethyl)-7-oxabicyclo[2.2.1]hept-2-ene (CID 14043961) is 5,6-difluoro-5,6-bis(trifluoromethyl)-7-oxabicyclo[2.2.1]hept-2-ene.
What is the SMILES notation for 5,6-difluoro-5,6-bis(trifluoromethyl)-7-oxabicyclo[2.2.1]hept-2-ene?
The canonical SMILES for 5,6-difluoro-5,6-bis(trifluoromethyl)-7-oxabicyclo[2.2.1]hept-2-ene is FC(F)(F)C1(F)C2C=CC(O2)C1(F)C(F)(F)F.
What is the InChIKey of 5,6-difluoro-5,6-bis(trifluoromethyl)-7-oxabicyclo[2.2.1]hept-2-ene?
The InChIKey is KGWCPMLZTYVDQI-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H4F8O/c9-5(7(11,12)13)3-1-2-4(17-3)6(5,10)8(14,15)16/h1-4H.
What are the key properties of 5,6-difluoro-5,6-bis(trifluoromethyl)-7-oxabicyclo[2.2.1]hept-2-ene?
5,6-difluoro-5,6-bis(trifluoromethyl)-7-oxabicyclo[2.2.1]hept-2-ene has a molecular weight of 268.10 g/mol, XLogP of 2.86, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 5,6-difluoro-5,6-bis(trifluoromethyl)-7-oxabicyclo[2.2.1]hept-2-ene is sourced from PubChem (CID 14043961), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).