About 2-oxidochromeno[2,3-c]pyridin-2-ium-5-one
2-oxidochromeno[2,3-c]pyridin-2-ium-5-one (PubChem CID 14044069) has the molecular formula C12H7NO3
and a molecular weight of 213.19 g/mol. Its IUPAC name is 2-oxidochromeno[2,3-c]pyridin-2-ium-5-one.
Molecular Properties
| Compound Name | 2-oxidochromeno[2,3-c]pyridin-2-ium-5-one |
| PubChem CID | 14044069 |
| Molecular Formula | C12H7NO3 |
| Molecular Weight | 213.19 g/mol |
| Exact Mass | 213.04 |
| IUPAC Name | 2-oxidochromeno[2,3-c]pyridin-2-ium-5-one |
| SMILES | O=c1c2ccccc2oc2c[n+]([O-])ccc12 |
| InChI | InChI=1S/C12H7NO3/c14-12-8-3-1-2-4-10(8)16-11-7-13(15)6-5-9(11)12/h1-7H |
| InChIKey | YZIDDLWJBJZBOA-UHFFFAOYSA-N |
| XLogP | 1.58 |
| TPSA | 57.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 213.19 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'N_oxide', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|
Analyze 2-oxidochromeno[2,3-c]pyridin-2-ium-5-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-oxidochromeno[2,3-c]pyridin-2-ium-5-one?
The IUPAC name of 2-oxidochromeno[2,3-c]pyridin-2-ium-5-one (CID 14044069) is 2-oxidochromeno[2,3-c]pyridin-2-ium-5-one.
What is the SMILES notation for 2-oxidochromeno[2,3-c]pyridin-2-ium-5-one?
The canonical SMILES for 2-oxidochromeno[2,3-c]pyridin-2-ium-5-one is O=c1c2ccccc2oc2c[n+]([O-])ccc12.
What is the InChIKey of 2-oxidochromeno[2,3-c]pyridin-2-ium-5-one?
The InChIKey is YZIDDLWJBJZBOA-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H7NO3/c14-12-8-3-1-2-4-10(8)16-11-7-13(15)6-5-9(11)12/h1-7H.
What are the key properties of 2-oxidochromeno[2,3-c]pyridin-2-ium-5-one?
2-oxidochromeno[2,3-c]pyridin-2-ium-5-one has a molecular weight of 213.19 g/mol, XLogP of 1.58, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-oxidochromeno[2,3-c]pyridin-2-ium-5-one is sourced from PubChem (CID 14044069), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).