C6H9N3O2S — CID 14044106
2-amino-5,6,8,8a-tetrahydroimidazo[5,1-c][1,4]thiazine-1,3-dione (PubChem CID 14044106) has the molecular formula C6H9N3O2S and a molecular weight of 187.22 g/mol. Its IUPAC name is 2-amino-5,6,8,8a-tetrahydroimidazo[5,1-c][1,4]thiazine-1,3-dione.
| Compound Name | 2-amino-5,6,8,8a-tetrahydroimidazo[5,1-c][1,4]thiazine-1,3-dione |
|---|---|
| PubChem CID | 14044106 |
| Molecular Formula | C6H9N3O2S |
| Molecular Weight | 187.22 g/mol |
| Exact Mass | 187.04 |
| IUPAC Name | 2-amino-5,6,8,8a-tetrahydroimidazo[5,1-c][1,4]thiazine-1,3-dione |
| SMILES | NN1C(=O)C2CSCCN2C1=O |
| InChI | InChI=1S/C6H9N3O2S/c7-9-5(10)4-3-12-2-1-8(4)6(9)11/h4H,1-3,7H2 |
| InChIKey | FKXGUGWKDOTWPP-UHFFFAOYSA-N |
| XLogP | -0.76 |
| TPSA | 66.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 187.22 |
| LogP ≤ 5 | -0.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'} |
|---|