About oxolane;tetrachlorostannane
oxolane;tetrachlorostannane (PubChem CID 14044337) has the molecular formula C4H8Cl4OSn
and a molecular weight of 332.63 g/mol. Its IUPAC name is oxolane;tetrachlorostannane.
Molecular Properties
| Compound Name | oxolane;tetrachlorostannane |
| PubChem CID | 14044337 |
| Molecular Formula | C4H8Cl4OSn |
| Molecular Weight | 332.63 g/mol |
| Exact Mass | 331.84 |
| IUPAC Name | oxolane;tetrachlorostannane |
| SMILES | C1CCOC1.Cl[Sn](Cl)(Cl)Cl |
| InChI | InChI=1S/C4H8O.4ClH.Sn/c1-2-4-5-3-1;;;;;/h1-4H2;4*1H;/q;;;;;+4/p-4 |
| InChIKey | GGUJRCZUZBUSTN-UHFFFAOYSA-J |
| XLogP | 3.17 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 332.63 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze oxolane;tetrachlorostannane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of oxolane;tetrachlorostannane?
The IUPAC name of oxolane;tetrachlorostannane (CID 14044337) is oxolane;tetrachlorostannane.
What is the SMILES notation for oxolane;tetrachlorostannane?
The canonical SMILES for oxolane;tetrachlorostannane is C1CCOC1.Cl[Sn](Cl)(Cl)Cl.
What is the InChIKey of oxolane;tetrachlorostannane?
The InChIKey is GGUJRCZUZBUSTN-UHFFFAOYSA-J. The full InChI is InChI=1S/C4H8O.4ClH.Sn/c1-2-4-5-3-1;;;;;/h1-4H2;4*1H;/q;;;;;+4/p-4.
What are the key properties of oxolane;tetrachlorostannane?
oxolane;tetrachlorostannane has a molecular weight of 332.63 g/mol, XLogP of 3.17, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for oxolane;tetrachlorostannane is sourced from PubChem (CID 14044337), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).