C14H12O2 — CID 14046660
7-methoxy-2-methyl-3-oxatetracyclo[6.4.1.04,13.09,12]trideca-1,4(13),5,7,10-pentaene (PubChem CID 14046660) has the molecular formula C14H12O2 and a molecular weight of 212.25 g/mol. Its IUPAC name is 7-methoxy-2-methyl-3-oxatetracyclo[6.4.1.04,13.09,12]trideca-1,4(13),5,7,10-pentaene.
| Compound Name | 7-methoxy-2-methyl-3-oxatetracyclo[6.4.1.04,13.09,12]trideca-1,4(13),5,7,10-pentaene |
|---|---|
| PubChem CID | 14046660 |
| Molecular Formula | C14H12O2 |
| Molecular Weight | 212.25 g/mol |
| Exact Mass | 212.08 |
| IUPAC Name | 7-methoxy-2-methyl-3-oxatetracyclo[6.4.1.04,13.09,12]trideca-1,4(13),5,7,10-pentaene |
| SMILES | COc1ccc2oc(C)c3c2c1C1C=CC31 |
| InChI | InChI=1S/C14H12O2/c1-7-12-8-3-4-9(8)13-10(15-2)5-6-11(16-7)14(12)13/h3-6,8-9H,1-2H3 |
| InChIKey | FBKIRQZKOOTEHV-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 22.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.25 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|