About 3-fluoroacenaphthylene
3-fluoroacenaphthylene (PubChem CID 14046850) has the molecular formula C12H7F
and a molecular weight of 170.19 g/mol. Its IUPAC name is 3-fluoroacenaphthylene.
Molecular Properties
| Compound Name | 3-fluoroacenaphthylene |
| PubChem CID | 14046850 |
| Molecular Formula | C12H7F |
| Molecular Weight | 170.19 g/mol |
| Exact Mass | 170.05 |
| IUPAC Name | 3-fluoroacenaphthylene |
| SMILES | Fc1ccc2cccc3c2c1C=C3 |
| InChI | InChI=1S/C12H7F/c13-11-7-5-9-3-1-2-8-4-6-10(11)12(8)9/h1-7H |
| InChIKey | VXCBBFRREAAQDQ-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 170.19 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze 3-fluoroacenaphthylene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-fluoroacenaphthylene?
The IUPAC name of 3-fluoroacenaphthylene (CID 14046850) is 3-fluoroacenaphthylene.
What is the SMILES notation for 3-fluoroacenaphthylene?
The canonical SMILES for 3-fluoroacenaphthylene is Fc1ccc2cccc3c2c1C=C3.
What is the InChIKey of 3-fluoroacenaphthylene?
The InChIKey is VXCBBFRREAAQDQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H7F/c13-11-7-5-9-3-1-2-8-4-6-10(11)12(8)9/h1-7H.
What are the key properties of 3-fluoroacenaphthylene?
3-fluoroacenaphthylene has a molecular weight of 170.19 g/mol, XLogP of 3.46, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 3-fluoroacenaphthylene is sourced from PubChem (CID 14046850), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).