About 3,4-dimethyl-4-nitrocyclohexa-2,5-dien-1-one
3,4-dimethyl-4-nitrocyclohexa-2,5-dien-1-one (PubChem CID 14046897) has the molecular formula C8H9NO3
and a molecular weight of 167.16 g/mol. Its IUPAC name is 3,4-dimethyl-4-nitrocyclohexa-2,5-dien-1-one.
Molecular Properties
| Compound Name | 3,4-dimethyl-4-nitrocyclohexa-2,5-dien-1-one |
| PubChem CID | 14046897 |
| Molecular Formula | C8H9NO3 |
| Molecular Weight | 167.16 g/mol |
| Exact Mass | 167.06 |
| IUPAC Name | 3,4-dimethyl-4-nitrocyclohexa-2,5-dien-1-one |
| SMILES | CC1=CC(=O)C=CC1(C)[N+](=O)[O-] |
| InChI | InChI=1S/C8H9NO3/c1-6-5-7(10)3-4-8(6,2)9(11)12/h3-5H,1-2H3 |
| InChIKey | AMSVZWXPJZDCEQ-UHFFFAOYSA-N |
| XLogP | 1.11 |
| TPSA | 60.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 167.16 |
| LogP ≤ 5 | 1.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 3,4-dimethyl-4-nitrocyclohexa-2,5-dien-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,4-dimethyl-4-nitrocyclohexa-2,5-dien-1-one?
The IUPAC name of 3,4-dimethyl-4-nitrocyclohexa-2,5-dien-1-one (CID 14046897) is 3,4-dimethyl-4-nitrocyclohexa-2,5-dien-1-one.
What is the SMILES notation for 3,4-dimethyl-4-nitrocyclohexa-2,5-dien-1-one?
The canonical SMILES for 3,4-dimethyl-4-nitrocyclohexa-2,5-dien-1-one is CC1=CC(=O)C=CC1(C)[N+](=O)[O-].
What is the InChIKey of 3,4-dimethyl-4-nitrocyclohexa-2,5-dien-1-one?
The InChIKey is AMSVZWXPJZDCEQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H9NO3/c1-6-5-7(10)3-4-8(6,2)9(11)12/h3-5H,1-2H3.
What are the key properties of 3,4-dimethyl-4-nitrocyclohexa-2,5-dien-1-one?
3,4-dimethyl-4-nitrocyclohexa-2,5-dien-1-one has a molecular weight of 167.16 g/mol, XLogP of 1.11, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3,4-dimethyl-4-nitrocyclohexa-2,5-dien-1-one is sourced from PubChem (CID 14046897), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).