C24H8Cl4O8 — CID 14046948
1,6,7,12-tetrachloroperylene-3,4,9,10-tetracarboxylic acid (PubChem CID 14046948) has the molecular formula C24H8Cl4O8 and a molecular weight of 566.13 g/mol. Its IUPAC name is 1,6,7,12-tetrachloroperylene-3,4,9,10-tetracarboxylic acid.
| Compound Name | 1,6,7,12-tetrachloroperylene-3,4,9,10-tetracarboxylic acid |
|---|---|
| PubChem CID | 14046948 |
| Molecular Formula | C24H8Cl4O8 |
| Molecular Weight | 566.13 g/mol |
| Exact Mass | 563.90 |
| IUPAC Name | 1,6,7,12-tetrachloroperylene-3,4,9,10-tetracarboxylic acid |
| SMILES | O=C(O)c1cc(Cl)c2c3c(Cl)cc(C(=O)O)c4c(C(=O)O)cc(Cl)c(c5c(Cl)cc(C(=O)O)c1c25)c43 |
| InChI | InChI=1S/C24H8Cl4O8/c25-9-1-5(21(29)30)13-6(22(31)32)2-11(27)17-18-12(28)4-8(24(35)36)14-7(23(33)34)3-10(26)16(20(14)18)15(9)19(13)17/h1-4H,(H,29,30)(H,31,32)(H,33,34)(H,35,36) |
| InChIKey | ZBOLYDUBEGGDKS-UHFFFAOYSA-N |
| XLogP | 7.14 |
| TPSA | 149.20 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 566.13 |
| LogP ≤ 5 | 7.14 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|