C25H26N2O2 — CID 14048240
9-methoxy-1',3',3',5',6'-pentamethylspiro[benzo[f][1,4]benzoxazine-3,2'-indole] (PubChem CID 14048240) has the molecular formula C25H26N2O2 and a molecular weight of 386.50 g/mol. Its IUPAC name is 9-methoxy-1',3',3',5',6'-pentamethylspiro[benzo[f][1,4]benzoxazine-3,2'-indole].
| Compound Name | 9-methoxy-1',3',3',5',6'-pentamethylspiro[benzo[f][1,4]benzoxazine-3,2'-indole] |
|---|---|
| PubChem CID | 14048240 |
| Molecular Formula | C25H26N2O2 |
| Molecular Weight | 386.50 g/mol |
| Exact Mass | 386.20 |
| IUPAC Name | 9-methoxy-1',3',3',5',6'-pentamethylspiro[benzo[f][1,4]benzoxazine-3,2'-indole] |
| SMILES | COc1ccc2ccc3c(c2c1)N=CC1(O3)N(C)c2cc(C)c(C)cc2C1(C)C |
| InChI | InChI=1S/C25H26N2O2/c1-15-11-20-21(12-16(15)2)27(5)25(24(20,3)4)14-26-23-19-13-18(28-6)9-7-17(19)8-10-22(23)29-25/h7-14H,1-6H3 |
| InChIKey | LEFLOQWREHLINR-UHFFFAOYSA-N |
| XLogP | 5.68 |
| TPSA | 34.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.50 |
| LogP ≤ 5 | 5.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |