About 2,3-diisocyanatohexane
2,3-diisocyanatohexane (PubChem CID 14048287) has the molecular formula C8H12N2O2
and a molecular weight of 168.20 g/mol. Its IUPAC name is 2,3-diisocyanatohexane.
Molecular Properties
| Compound Name | 2,3-diisocyanatohexane |
| PubChem CID | 14048287 |
| Molecular Formula | C8H12N2O2 |
| Molecular Weight | 168.20 g/mol |
| Exact Mass | 168.09 |
| IUPAC Name | 2,3-diisocyanatohexane |
| SMILES | CCCC(N=C=O)C(C)N=C=O |
| InChI | InChI=1S/C8H12N2O2/c1-3-4-8(10-6-12)7(2)9-5-11/h7-8H,3-4H2,1-2H3 |
| InChIKey | GQQFPRRAGKUBCC-UHFFFAOYSA-N |
| XLogP | 1.22 |
| TPSA | 58.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 168.20 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isocyanate', 'substructure': 'N/A'} |
|---|
Analyze 2,3-diisocyanatohexane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,3-diisocyanatohexane?
The IUPAC name of 2,3-diisocyanatohexane (CID 14048287) is 2,3-diisocyanatohexane.
What is the SMILES notation for 2,3-diisocyanatohexane?
The canonical SMILES for 2,3-diisocyanatohexane is CCCC(N=C=O)C(C)N=C=O.
What is the InChIKey of 2,3-diisocyanatohexane?
The InChIKey is GQQFPRRAGKUBCC-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H12N2O2/c1-3-4-8(10-6-12)7(2)9-5-11/h7-8H,3-4H2,1-2H3.
What are the key properties of 2,3-diisocyanatohexane?
2,3-diisocyanatohexane has a molecular weight of 168.20 g/mol, XLogP of 1.22, 5 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2,3-diisocyanatohexane is sourced from PubChem (CID 14048287), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).