About iron(2+);bis(naphthalene-2-carboxylate)
iron(2+);bis(naphthalene-2-carboxylate) (PubChem CID 14048875) has the molecular formula C22H14FeO4
and a molecular weight of 398.20 g/mol. Its IUPAC name is iron(2+);bis(naphthalene-2-carboxylate).
Molecular Properties
| Compound Name | iron(2+);bis(naphthalene-2-carboxylate) |
| PubChem CID | 14048875 |
| Molecular Formula | C22H14FeO4 |
| Molecular Weight | 398.20 g/mol |
| Exact Mass | 398.02 |
| IUPAC Name | iron(2+);bis(naphthalene-2-carboxylate) |
| SMILES | O=C([O-])c1ccc2ccccc2c1.O=C([O-])c1ccc2ccccc2c1.[Fe+2] |
| InChI | InChI=1S/2C11H8O2.Fe/c2*12-11(13)10-6-5-8-3-1-2-4-9(8)7-10;/h2*1-7H,(H,12,13);/q;;+2/p-2 |
| InChIKey | PBDSMEGLJGEMDK-UHFFFAOYSA-L |
| XLogP | 2.40 |
| TPSA | 80.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 398.20 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze iron(2+);bis(naphthalene-2-carboxylate) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of iron(2+);bis(naphthalene-2-carboxylate)?
The IUPAC name of iron(2+);bis(naphthalene-2-carboxylate) (CID 14048875) is iron(2+);bis(naphthalene-2-carboxylate).
What is the SMILES notation for iron(2+);bis(naphthalene-2-carboxylate)?
The canonical SMILES for iron(2+);bis(naphthalene-2-carboxylate) is O=C([O-])c1ccc2ccccc2c1.O=C([O-])c1ccc2ccccc2c1.[Fe+2].
What is the InChIKey of iron(2+);bis(naphthalene-2-carboxylate)?
The InChIKey is PBDSMEGLJGEMDK-UHFFFAOYSA-L. The full InChI is InChI=1S/2C11H8O2.Fe/c2*12-11(13)10-6-5-8-3-1-2-4-9(8)7-10;/h2*1-7H,(H,12,13);/q;;+2/p-2.
What are the key properties of iron(2+);bis(naphthalene-2-carboxylate)?
iron(2+);bis(naphthalene-2-carboxylate) has a molecular weight of 398.20 g/mol, XLogP of 2.40, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for iron(2+);bis(naphthalene-2-carboxylate) is sourced from PubChem (CID 14048875), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).