C16H15FN4O2S2 — CID 14049876
6-fluoro-5-(1-oxo-3-sulfanylidene-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,2-a]pyridazin-2-yl)-3-prop-2-enyl-1,3-benzothiazol-2-one (PubChem CID 14049876) has the molecular formula C16H15FN4O2S2 and a molecular weight of 378.45 g/mol. Its IUPAC name is 6-fluoro-5-(1-oxo-3-sulfanylidene-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,2-a]pyridazin-2-yl)-3-prop-2-enyl-1,3-benzothiazol-2-one.
| Compound Name | 6-fluoro-5-(1-oxo-3-sulfanylidene-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,2-a]pyridazin-2-yl)-3-prop-2-enyl-1,3-benzothiazol-2-one |
|---|---|
| PubChem CID | 14049876 |
| Molecular Formula | C16H15FN4O2S2 |
| Molecular Weight | 378.45 g/mol |
| Exact Mass | 378.06 |
| IUPAC Name | 6-fluoro-5-(1-oxo-3-sulfanylidene-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,2-a]pyridazin-2-yl)-3-prop-2-enyl-1,3-benzothiazol-2-one |
| SMILES | C=CCn1c(=O)sc2cc(F)c(-n3c(=O)n4n(c3=S)CCCC4)cc21 |
| InChI | InChI=1S/C16H15FN4O2S2/c1-2-5-18-12-9-11(10(17)8-13(12)25-16(18)23)21-14(22)19-6-3-4-7-20(19)15(21)24/h2,8-9H,1,3-7H2 |
| InChIKey | YNVROIHAMHLRER-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 53.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.45 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|