About 1-[(3,5-difluorophenyl)methyl]-2H-tetrazole-5-thione
1-[(3,5-difluorophenyl)methyl]-2H-tetrazole-5-thione (PubChem CID 14049916) has the molecular formula C8H6F2N4S
and a molecular weight of 228.23 g/mol. Its IUPAC name is 1-[(3,5-difluorophenyl)methyl]-2H-tetrazole-5-thione.
Molecular Properties
| Compound Name | 1-[(3,5-difluorophenyl)methyl]-2H-tetrazole-5-thione |
| PubChem CID | 14049916 |
| Molecular Formula | C8H6F2N4S |
| Molecular Weight | 228.23 g/mol |
| Exact Mass | 228.03 |
| IUPAC Name | 1-[(3,5-difluorophenyl)methyl]-2H-tetrazole-5-thione |
| SMILES | Fc1cc(F)cc(Cn2[nH]nnc2=S)c1 |
| InChI | InChI=1S/C8H6F2N4S/c9-6-1-5(2-7(10)3-6)4-14-8(15)11-12-13-14/h1-3H,4H2,(H,11,13,15) |
| InChIKey | PDIWCPKMXOQPQE-UHFFFAOYSA-N |
| XLogP | 1.66 |
| TPSA | 46.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 228.23 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 1-[(3,5-difluorophenyl)methyl]-2H-tetrazole-5-thione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[(3,5-difluorophenyl)methyl]-2H-tetrazole-5-thione?
The IUPAC name of 1-[(3,5-difluorophenyl)methyl]-2H-tetrazole-5-thione (CID 14049916) is 1-[(3,5-difluorophenyl)methyl]-2H-tetrazole-5-thione.
What is the SMILES notation for 1-[(3,5-difluorophenyl)methyl]-2H-tetrazole-5-thione?
The canonical SMILES for 1-[(3,5-difluorophenyl)methyl]-2H-tetrazole-5-thione is Fc1cc(F)cc(Cn2[nH]nnc2=S)c1.
What is the InChIKey of 1-[(3,5-difluorophenyl)methyl]-2H-tetrazole-5-thione?
The InChIKey is PDIWCPKMXOQPQE-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H6F2N4S/c9-6-1-5(2-7(10)3-6)4-14-8(15)11-12-13-14/h1-3H,4H2,(H,11,13,15).
What are the key properties of 1-[(3,5-difluorophenyl)methyl]-2H-tetrazole-5-thione?
1-[(3,5-difluorophenyl)methyl]-2H-tetrazole-5-thione has a molecular weight of 228.23 g/mol, XLogP of 1.66, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[(3,5-difluorophenyl)methyl]-2H-tetrazole-5-thione is sourced from PubChem (CID 14049916), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).