C9H17NO6 — CID 140500778
(2R,3R,4R)-2,3,4,5-tetrahydroxy-1-morpholin-4-ylpentan-1-one (PubChem CID 140500778) has the molecular formula C9H17NO6 and a molecular weight of 235.24 g/mol. Its IUPAC name is (2R,3R,4R)-2,3,4,5-tetrahydroxy-1-morpholin-4-ylpentan-1-one.
| Compound Name | (2R,3R,4R)-2,3,4,5-tetrahydroxy-1-morpholin-4-ylpentan-1-one |
|---|---|
| PubChem CID | 140500778 |
| Molecular Formula | C9H17NO6 |
| Molecular Weight | 235.24 g/mol |
| Exact Mass | 235.11 |
| IUPAC Name | (2R,3R,4R)-2,3,4,5-tetrahydroxy-1-morpholin-4-ylpentan-1-one |
| SMILES | O=C([C@H](O)[C@H](O)[C@H](O)CO)N1CCOCC1 |
| InChI | InChI=1S/C9H17NO6/c11-5-6(12)7(13)8(14)9(15)10-1-3-16-4-2-10/h6-8,11-14H,1-5H2/t6-,7-,8-/m1/s1 |
| InChIKey | NCYXPKWAIVBYQT-BWZBUEFSSA-N |
| XLogP | -3.08 |
| TPSA | 110.46 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.24 |
| LogP ≤ 5 | -3.08 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |