C12H12F6O2 — CID 140501856
4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)tricyclo[4.2.1.02,5]non-7-en-3-ol (PubChem CID 140501856) has the molecular formula C12H12F6O2 and a molecular weight of 302.21 g/mol. Its IUPAC name is 4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)tricyclo[4.2.1.02,5]non-7-en-3-ol.
| Compound Name | 4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)tricyclo[4.2.1.02,5]non-7-en-3-ol |
|---|---|
| PubChem CID | 140501856 |
| Molecular Formula | C12H12F6O2 |
| Molecular Weight | 302.21 g/mol |
| Exact Mass | 302.07 |
| IUPAC Name | 4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)tricyclo[4.2.1.02,5]non-7-en-3-ol |
| SMILES | OC1C2C3C=CC(C3)C2C1C(O)(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C12H12F6O2/c13-11(14,15)10(20,12(16,17)18)8-6-4-1-2-5(3-4)7(6)9(8)19/h1-2,4-9,19-20H,3H2 |
| InChIKey | QEBSAFJDYYCPPX-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.21 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|