C16H23ClNO2S+ — CID 140501939
methyl 2-(2-chlorocyclohexyl)-2-(4,5,6,7-tetrahydrothieno[3,2-c]pyridin-5-ium-5-yl)acetate (PubChem CID 140501939) has the molecular formula C16H23ClNO2S+ and a molecular weight of 328.88 g/mol. Its IUPAC name is methyl 2-(2-chlorocyclohexyl)-2-(4,5,6,7-tetrahydrothieno[3,2-c]pyridin-5-ium-5-yl)acetate.
| Compound Name | methyl 2-(2-chlorocyclohexyl)-2-(4,5,6,7-tetrahydrothieno[3,2-c]pyridin-5-ium-5-yl)acetate |
|---|---|
| PubChem CID | 140501939 |
| Molecular Formula | C16H23ClNO2S+ |
| Molecular Weight | 328.88 g/mol |
| Exact Mass | 328.11 |
| IUPAC Name | methyl 2-(2-chlorocyclohexyl)-2-(4,5,6,7-tetrahydrothieno[3,2-c]pyridin-5-ium-5-yl)acetate |
| SMILES | COC(=O)C(C1CCCCC1Cl)[NH+]1CCc2sccc2C1 |
| InChI | InChI=1S/C16H22ClNO2S/c1-20-16(19)15(12-4-2-3-5-13(12)17)18-8-6-14-11(10-18)7-9-21-14/h7,9,12-13,15H,2-6,8,10H2,1H3/p+1 |
| InChIKey | XKOQNWATMWALHH-UHFFFAOYSA-O |
| XLogP | 2.03 |
| TPSA | 30.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.88 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|