C33H68O8Si3 — CID 140502535
[(2S)-2-[(2R,3S)-3-[(1S,2S,3S,4S)-2,4-bis[[tert-butyl(dimethyl)silyl]oxymethyl]-3-hydroxy-5-oxo-1-triethylsilyloxypentyl]-3-methyloxiran-2-yl]propyl] acetate (PubChem CID 140502535) has the molecular formula C33H68O8Si3 and a molecular weight of 677.16 g/mol. Its IUPAC name is [(2S)-2-[(2R,3S)-3-[(1S,2S,3S,4S)-2,4-bis[[tert-butyl(dimethyl)silyl]oxymethyl]-3-hydroxy-5-oxo-1-triethylsilyloxypentyl]-3-methyloxiran-2-yl]propyl] acetate.
| Compound Name | [(2S)-2-[(2R,3S)-3-[(1S,2S,3S,4S)-2,4-bis[[tert-butyl(dimethyl)silyl]oxymethyl]-3-hydroxy-5-oxo-1-triethylsilyloxypentyl]-3-methyloxiran-2-yl]propyl] acetate |
|---|---|
| PubChem CID | 140502535 |
| Molecular Formula | C33H68O8Si3 |
| Molecular Weight | 677.16 g/mol |
| Exact Mass | 676.42 |
| IUPAC Name | [(2S)-2-[(2R,3S)-3-[(1S,2S,3S,4S)-2,4-bis[[tert-butyl(dimethyl)silyl]oxymethyl]-3-hydroxy-5-oxo-1-triethylsilyloxypentyl]-3-methyloxiran-2-yl]propyl] acetate |
| SMILES | CC[Si](CC)(CC)O[C@@H]([C@@H](CO[Si](C)(C)C(C)(C)C)[C@H](O)[C@@H](C=O)CO[Si](C)(C)C(C)(C)C)[C@@]1(C)O[C@@H]1[C@@H](C)COC(C)=O |
| InChI | InChI=1S/C33H68O8Si3/c1-17-44(18-2,19-3)41-30(33(12)29(40-33)24(4)21-37-25(5)35)27(23-39-43(15,16)32(9,10)11)28(36)26(20-34)22-38-42(13,14)31(6,7)8/h20,24,26-30,36H,17-19,21-23H2,1-16H3/t24-,26-,27-,28+,29+,30-,33-/m0/s1 |
| InChIKey | XBPXTUDEBJOEHS-MBUIHJIMSA-N |
| XLogP | 7.57 |
| TPSA | 103.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 677.16 |
| LogP ≤ 5 | 7.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|