C51H89N3 — CID 140503090
6-[4-[(E)-2-[4-[bis(4-methylcyclohexyl)amino]cyclohexyl]ethenyl]cyclohexyl]-N,N-bis(4-methylcyclohexyl)-1,2,3,4,4a,5,6,7,8,8a-decahydroquinolin-2-amine (PubChem CID 140503090) has the molecular formula C51H89N3 and a molecular weight of 744.29 g/mol. Its IUPAC name is 6-[4-[(E)-2-[4-[bis(4-methylcyclohexyl)amino]cyclohexyl]ethenyl]cyclohexyl]-N,N-bis(4-methylcyclohexyl)-1,2,3,4,4a,5,6,7,8,8a-decahydroquinolin-2-amine.
| Compound Name | 6-[4-[(E)-2-[4-[bis(4-methylcyclohexyl)amino]cyclohexyl]ethenyl]cyclohexyl]-N,N-bis(4-methylcyclohexyl)-1,2,3,4,4a,5,6,7,8,8a-decahydroquinolin-2-amine |
|---|---|
| PubChem CID | 140503090 |
| Molecular Formula | C51H89N3 |
| Molecular Weight | 744.29 g/mol |
| Exact Mass | 743.71 |
| IUPAC Name | 6-[4-[(E)-2-[4-[bis(4-methylcyclohexyl)amino]cyclohexyl]ethenyl]cyclohexyl]-N,N-bis(4-methylcyclohexyl)-1,2,3,4,4a,5,6,7,8,8a-decahydroquinolin-2-amine |
| SMILES | CC1CCC(N(C2CCC(C)CC2)C2CCC(/C=C/C3CCC(C4CCC5NC(N(C6CCC(C)CC6)C6CCC(C)CC6)CCC5C4)CC3)CC2)CC1 |
| InChI | InChI=1S/C51H89N3/c1-36-5-23-45(24-6-36)53(46-25-7-37(2)8-26-46)47-31-17-41(18-32-47)14-13-40-15-19-42(20-16-40)43-21-33-50-44(35-43)22-34-51(52-50)54(48-27-9-38(3)10-28-48)49-29-11-39(4)12-30-49/h13-14,36-52H,5-12,15-35H2,1-4H3/b14-13+ |
| InChIKey | AFUXFUMUAWLWHY-BUHFOSPRSA-N |
| XLogP | 13.32 |
| TPSA | 18.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 744.29 |
| LogP ≤ 5 | 13.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|