C19H19FN2O — CID 140503816
4-fluoro-N,N-dimethyl-5,5-diphenyl-2H-pyrrole-1-carboxamide (PubChem CID 140503816) has the molecular formula C19H19FN2O and a molecular weight of 310.37 g/mol. Its IUPAC name is 4-fluoro-N,N-dimethyl-5,5-diphenyl-2H-pyrrole-1-carboxamide.
| Compound Name | 4-fluoro-N,N-dimethyl-5,5-diphenyl-2H-pyrrole-1-carboxamide |
|---|---|
| PubChem CID | 140503816 |
| Molecular Formula | C19H19FN2O |
| Molecular Weight | 310.37 g/mol |
| Exact Mass | 310.15 |
| IUPAC Name | 4-fluoro-N,N-dimethyl-5,5-diphenyl-2H-pyrrole-1-carboxamide |
| SMILES | CN(C)C(=O)N1CC=C(F)C1(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C19H19FN2O/c1-21(2)18(23)22-14-13-17(20)19(22,15-9-5-3-6-10-15)16-11-7-4-8-12-16/h3-13H,14H2,1-2H3 |
| InChIKey | SYLCRDUAFREAIJ-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.37 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |