C26H20F3N5O3S — CID 140503900
5-[(1S)-1-aminoethyl]-N-(1-benzothiophene-3-carboximidoyl)-2-[8-methoxy-2-(trifluoromethyl)quinolin-5-yl]-1,3-oxazole-4-carboxamide (PubChem CID 140503900) has the molecular formula C26H20F3N5O3S and a molecular weight of 539.54 g/mol. Its IUPAC name is 5-[(1S)-1-aminoethyl]-N-(1-benzothiophene-3-carboximidoyl)-2-[8-methoxy-2-(trifluoromethyl)quinolin-5-yl]-1,3-oxazole-4-carboxamide.
| Compound Name | 5-[(1S)-1-aminoethyl]-N-(1-benzothiophene-3-carboximidoyl)-2-[8-methoxy-2-(trifluoromethyl)quinolin-5-yl]-1,3-oxazole-4-carboxamide |
|---|---|
| PubChem CID | 140503900 |
| Molecular Formula | C26H20F3N5O3S |
| Molecular Weight | 539.54 g/mol |
| Exact Mass | 539.12 |
| IUPAC Name | 5-[(1S)-1-aminoethyl]-N-(1-benzothiophene-3-carboximidoyl)-2-[8-methoxy-2-(trifluoromethyl)quinolin-5-yl]-1,3-oxazole-4-carboxamide |
| SMILES | [H]/N=C(/NC(=O)c1nc(-c2ccc(OC)c3nc(C(F)(F)F)ccc23)oc1[C@H](C)N)c1csc2ccccc12 |
| InChI | InChI=1S/C26H20F3N5O3S/c1-12(30)22-21(24(35)34-23(31)16-11-38-18-6-4-3-5-13(16)18)33-25(37-22)15-7-9-17(36-2)20-14(15)8-10-19(32-20)26(27,28)29/h3-12H,30H2,1-2H3,(H2,31,34,35)/t12-/m0/s1 |
| InChIKey | JUGAOLAVWKGGRR-LBPRGKRZSA-N |
| XLogP | 5.91 |
| TPSA | 127.12 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 539.54 |
| LogP ≤ 5 | 5.91 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|