About 6,7-dichloro-3-[3-(3-hydroxypiperidin-2-yl)-2-oxopropyl]thieno[3,2-d]pyrimidin-4-one
6,7-dichloro-3-[3-(3-hydroxypiperidin-2-yl)-2-oxopropyl]thieno[3,2-d]pyrimidin-4-one (PubChem CID 14050409) has the molecular formula C14H15Cl2N3O3S
and a molecular weight of 376.27 g/mol. Its IUPAC name is 6,7-dichloro-3-[3-(3-hydroxypiperidin-2-yl)-2-oxopropyl]thieno[3,2-d]pyrimidin-4-one.
Molecular Properties
| Compound Name | 6,7-dichloro-3-[3-(3-hydroxypiperidin-2-yl)-2-oxopropyl]thieno[3,2-d]pyrimidin-4-one |
| PubChem CID | 14050409 |
| Molecular Formula | C14H15Cl2N3O3S |
| Molecular Weight | 376.27 g/mol |
| Exact Mass | 375.02 |
| IUPAC Name | 6,7-dichloro-3-[3-(3-hydroxypiperidin-2-yl)-2-oxopropyl]thieno[3,2-d]pyrimidin-4-one |
| SMILES | O=C(CC1NCCCC1O)Cn1cnc2c(Cl)c(Cl)sc2c1=O |
| InChI | InChI=1S/C14H15Cl2N3O3S/c15-10-11-12(23-13(10)16)14(22)19(6-18-11)5-7(20)4-8-9(21)2-1-3-17-8/h6,8-9,17,21H,1-5H2 |
| InChIKey | MXSRVDYRABBABX-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 84.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 376.27 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze 6,7-dichloro-3-[3-(3-hydroxypiperidin-2-yl)-2-oxopropyl]thieno[3,2-d]pyrimidin-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6,7-dichloro-3-[3-(3-hydroxypiperidin-2-yl)-2-oxopropyl]thieno[3,2-d]pyrimidin-4-one?
The IUPAC name of 6,7-dichloro-3-[3-(3-hydroxypiperidin-2-yl)-2-oxopropyl]thieno[3,2-d]pyrimidin-4-one (CID 14050409) is 6,7-dichloro-3-[3-(3-hydroxypiperidin-2-yl)-2-oxopropyl]thieno[3,2-d]pyrimidin-4-one.
What is the SMILES notation for 6,7-dichloro-3-[3-(3-hydroxypiperidin-2-yl)-2-oxopropyl]thieno[3,2-d]pyrimidin-4-one?
The canonical SMILES for 6,7-dichloro-3-[3-(3-hydroxypiperidin-2-yl)-2-oxopropyl]thieno[3,2-d]pyrimidin-4-one is O=C(CC1NCCCC1O)Cn1cnc2c(Cl)c(Cl)sc2c1=O.
What is the InChIKey of 6,7-dichloro-3-[3-(3-hydroxypiperidin-2-yl)-2-oxopropyl]thieno[3,2-d]pyrimidin-4-one?
The InChIKey is MXSRVDYRABBABX-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H15Cl2N3O3S/c15-10-11-12(23-13(10)16)14(22)19(6-18-11)5-7(20)4-8-9(21)2-1-3-17-8/h6,8-9,17,21H,1-5H2.
What are the key properties of 6,7-dichloro-3-[3-(3-hydroxypiperidin-2-yl)-2-oxopropyl]thieno[3,2-d]pyrimidin-4-one?
6,7-dichloro-3-[3-(3-hydroxypiperidin-2-yl)-2-oxopropyl]thieno[3,2-d]pyrimidin-4-one has a molecular weight of 376.27 g/mol, XLogP of 1.84, 4 rotatable bonds, 2 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 6,7-dichloro-3-[3-(3-hydroxypiperidin-2-yl)-2-oxopropyl]thieno[3,2-d]pyrimidin-4-one is sourced from PubChem (CID 14050409), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).