About [1,5-bis(trifluoromethyl)cyclohexa-2,4-dien-1-yl]methanamine;hydrochloride
[1,5-bis(trifluoromethyl)cyclohexa-2,4-dien-1-yl]methanamine;hydrochloride (PubChem CID 140504272) has the molecular formula C9H10ClF6N
and a molecular weight of 281.63 g/mol. Its IUPAC name is [1,5-bis(trifluoromethyl)cyclohexa-2,4-dien-1-yl]methanamine;hydrochloride.
Molecular Properties
| Compound Name | [1,5-bis(trifluoromethyl)cyclohexa-2,4-dien-1-yl]methanamine;hydrochloride |
| PubChem CID | 140504272 |
| Molecular Formula | C9H10ClF6N |
| Molecular Weight | 281.63 g/mol |
| Exact Mass | 281.04 |
| IUPAC Name | [1,5-bis(trifluoromethyl)cyclohexa-2,4-dien-1-yl]methanamine;hydrochloride |
| SMILES | Cl.NCC1(C(F)(F)F)C=CC=C(C(F)(F)F)C1 |
| InChI | InChI=1S/C9H9F6N.ClH/c10-8(11,12)6-2-1-3-7(4-6,5-16)9(13,14)15;/h1-3H,4-5,16H2;1H |
| InChIKey | MRRXDVWWNIAHHC-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 281.63 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze [1,5-bis(trifluoromethyl)cyclohexa-2,4-dien-1-yl]methanamine;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [1,5-bis(trifluoromethyl)cyclohexa-2,4-dien-1-yl]methanamine;hydrochloride?
The IUPAC name of [1,5-bis(trifluoromethyl)cyclohexa-2,4-dien-1-yl]methanamine;hydrochloride (CID 140504272) is [1,5-bis(trifluoromethyl)cyclohexa-2,4-dien-1-yl]methanamine;hydrochloride.
What is the SMILES notation for [1,5-bis(trifluoromethyl)cyclohexa-2,4-dien-1-yl]methanamine;hydrochloride?
The canonical SMILES for [1,5-bis(trifluoromethyl)cyclohexa-2,4-dien-1-yl]methanamine;hydrochloride is Cl.NCC1(C(F)(F)F)C=CC=C(C(F)(F)F)C1.
What is the InChIKey of [1,5-bis(trifluoromethyl)cyclohexa-2,4-dien-1-yl]methanamine;hydrochloride?
The InChIKey is MRRXDVWWNIAHHC-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H9F6N.ClH/c10-8(11,12)6-2-1-3-7(4-6,5-16)9(13,14)15;/h1-3H,4-5,16H2;1H.
What are the key properties of [1,5-bis(trifluoromethyl)cyclohexa-2,4-dien-1-yl]methanamine;hydrochloride?
[1,5-bis(trifluoromethyl)cyclohexa-2,4-dien-1-yl]methanamine;hydrochloride has a molecular weight of 281.63 g/mol, XLogP of 3.36, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for [1,5-bis(trifluoromethyl)cyclohexa-2,4-dien-1-yl]methanamine;hydrochloride is sourced from PubChem (CID 140504272), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).