C25H30N2O3 — CID 140505091
1-[4-[(4aR,10bR)-8,9-dimethoxy-1,2,3,4,4a,10b-hexahydrophenanthridin-6-yl]phenyl]-N-ethoxyethanimine (PubChem CID 140505091) has the molecular formula C25H30N2O3 and a molecular weight of 406.53 g/mol. Its IUPAC name is 1-[4-[(4aR,10bR)-8,9-dimethoxy-1,2,3,4,4a,10b-hexahydrophenanthridin-6-yl]phenyl]-N-ethoxyethanimine.
| Compound Name | 1-[4-[(4aR,10bR)-8,9-dimethoxy-1,2,3,4,4a,10b-hexahydrophenanthridin-6-yl]phenyl]-N-ethoxyethanimine |
|---|---|
| PubChem CID | 140505091 |
| Molecular Formula | C25H30N2O3 |
| Molecular Weight | 406.53 g/mol |
| Exact Mass | 406.23 |
| IUPAC Name | 1-[4-[(4aR,10bR)-8,9-dimethoxy-1,2,3,4,4a,10b-hexahydrophenanthridin-6-yl]phenyl]-N-ethoxyethanimine |
| SMILES | CCON=C(C)c1ccc(C2=N[C@@H]3CCCC[C@@H]3c3cc(OC)c(OC)cc32)cc1 |
| InChI | InChI=1S/C25H30N2O3/c1-5-30-27-16(2)17-10-12-18(13-11-17)25-21-15-24(29-4)23(28-3)14-20(21)19-8-6-7-9-22(19)26-25/h10-15,19,22H,5-9H2,1-4H3/t19-,22-/m1/s1 |
| InChIKey | LPCZTURZPMZHSN-DENIHFKCSA-N |
| XLogP | 5.34 |
| TPSA | 52.41 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.53 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|