C22H17N3O2 — CID 140505140
[4-(3,5-dicyano-2,6-dimethyl-1,4-dihydropyridin-4-yl)phenyl] benzoate (PubChem CID 140505140) has the molecular formula C22H17N3O2 and a molecular weight of 355.40 g/mol. Its IUPAC name is [4-(3,5-dicyano-2,6-dimethyl-1,4-dihydropyridin-4-yl)phenyl] benzoate.
| Compound Name | [4-(3,5-dicyano-2,6-dimethyl-1,4-dihydropyridin-4-yl)phenyl] benzoate |
|---|---|
| PubChem CID | 140505140 |
| Molecular Formula | C22H17N3O2 |
| Molecular Weight | 355.40 g/mol |
| Exact Mass | 355.13 |
| IUPAC Name | [4-(3,5-dicyano-2,6-dimethyl-1,4-dihydropyridin-4-yl)phenyl] benzoate |
| SMILES | CC1=C(C#N)C(c2ccc(OC(=O)c3ccccc3)cc2)C(C#N)=C(C)N1 |
| InChI | InChI=1S/C22H17N3O2/c1-14-19(12-23)21(20(13-24)15(2)25-14)16-8-10-18(11-9-16)27-22(26)17-6-4-3-5-7-17/h3-11,21,25H,1-2H3 |
| InChIKey | FHHDTRNQTUXJGJ-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 85.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.40 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|