About 1-chloro-1-phenyl-4,5-dihydro-1,2-thiazole
1-chloro-1-phenyl-4,5-dihydro-1,2-thiazole (PubChem CID 140505237) has the molecular formula C9H10ClNS
and a molecular weight of 199.71 g/mol. Its IUPAC name is 1-chloro-1-phenyl-4,5-dihydro-1,2-thiazole.
Molecular Properties
| Compound Name | 1-chloro-1-phenyl-4,5-dihydro-1,2-thiazole |
| PubChem CID | 140505237 |
| Molecular Formula | C9H10ClNS |
| Molecular Weight | 199.71 g/mol |
| Exact Mass | 199.02 |
| IUPAC Name | 1-chloro-1-phenyl-4,5-dihydro-1,2-thiazole |
| SMILES | ClS1(c2ccccc2)CCC=N1 |
| InChI | InChI=1S/C9H10ClNS/c10-12(8-4-7-11-12)9-5-2-1-3-6-9/h1-3,5-7H,4,8H2 |
| InChIKey | MCQNFPZNXASDFL-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 199.71 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 1-chloro-1-phenyl-4,5-dihydro-1,2-thiazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-chloro-1-phenyl-4,5-dihydro-1,2-thiazole?
The IUPAC name of 1-chloro-1-phenyl-4,5-dihydro-1,2-thiazole (CID 140505237) is 1-chloro-1-phenyl-4,5-dihydro-1,2-thiazole.
What is the SMILES notation for 1-chloro-1-phenyl-4,5-dihydro-1,2-thiazole?
The canonical SMILES for 1-chloro-1-phenyl-4,5-dihydro-1,2-thiazole is ClS1(c2ccccc2)CCC=N1.
What is the InChIKey of 1-chloro-1-phenyl-4,5-dihydro-1,2-thiazole?
The InChIKey is MCQNFPZNXASDFL-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H10ClNS/c10-12(8-4-7-11-12)9-5-2-1-3-6-9/h1-3,5-7H,4,8H2.
What are the key properties of 1-chloro-1-phenyl-4,5-dihydro-1,2-thiazole?
1-chloro-1-phenyl-4,5-dihydro-1,2-thiazole has a molecular weight of 199.71 g/mol, XLogP of 3.39, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-chloro-1-phenyl-4,5-dihydro-1,2-thiazole is sourced from PubChem (CID 140505237), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).