About ethyl (2Z)-2-(2,2-dibromocyclopropyl)oxyimino-2-(2-methyl-1,3-dioxolan-2-yl)acetate
ethyl (2Z)-2-(2,2-dibromocyclopropyl)oxyimino-2-(2-methyl-1,3-dioxolan-2-yl)acetate (PubChem CID 14050529) has the molecular formula C11H15Br2NO5
and a molecular weight of 401.05 g/mol. Its IUPAC name is ethyl (2Z)-2-(2,2-dibromocyclopropyl)oxyimino-2-(2-methyl-1,3-dioxolan-2-yl)acetate.
Molecular Properties
| Compound Name | ethyl (2Z)-2-(2,2-dibromocyclopropyl)oxyimino-2-(2-methyl-1,3-dioxolan-2-yl)acetate |
| PubChem CID | 14050529 |
| Molecular Formula | C11H15Br2NO5 |
| Molecular Weight | 401.05 g/mol |
| Exact Mass | 398.93 |
| IUPAC Name | ethyl (2Z)-2-(2,2-dibromocyclopropyl)oxyimino-2-(2-methyl-1,3-dioxolan-2-yl)acetate |
| SMILES | CCOC(=O)/C(=N\OC1CC1(Br)Br)C1(C)OCCO1 |
| InChI | InChI=1S/C11H15Br2NO5/c1-3-16-9(15)8(10(2)17-4-5-18-10)14-19-7-6-11(7,12)13/h7H,3-6H2,1-2H3/b14-8+ |
| InChIKey | DLXAKZAIYYTWTR-RIYZIHGNSA-N |
| XLogP | 1.94 |
| TPSA | 66.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 401.05 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze ethyl (2Z)-2-(2,2-dibromocyclopropyl)oxyimino-2-(2-methyl-1,3-dioxolan-2-yl)acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl (2Z)-2-(2,2-dibromocyclopropyl)oxyimino-2-(2-methyl-1,3-dioxolan-2-yl)acetate?
The IUPAC name of ethyl (2Z)-2-(2,2-dibromocyclopropyl)oxyimino-2-(2-methyl-1,3-dioxolan-2-yl)acetate (CID 14050529) is ethyl (2Z)-2-(2,2-dibromocyclopropyl)oxyimino-2-(2-methyl-1,3-dioxolan-2-yl)acetate.
What is the SMILES notation for ethyl (2Z)-2-(2,2-dibromocyclopropyl)oxyimino-2-(2-methyl-1,3-dioxolan-2-yl)acetate?
The canonical SMILES for ethyl (2Z)-2-(2,2-dibromocyclopropyl)oxyimino-2-(2-methyl-1,3-dioxolan-2-yl)acetate is CCOC(=O)/C(=N\OC1CC1(Br)Br)C1(C)OCCO1.
What is the InChIKey of ethyl (2Z)-2-(2,2-dibromocyclopropyl)oxyimino-2-(2-methyl-1,3-dioxolan-2-yl)acetate?
The InChIKey is DLXAKZAIYYTWTR-RIYZIHGNSA-N. The full InChI is InChI=1S/C11H15Br2NO5/c1-3-16-9(15)8(10(2)17-4-5-18-10)14-19-7-6-11(7,12)13/h7H,3-6H2,1-2H3/b14-8+.
What are the key properties of ethyl (2Z)-2-(2,2-dibromocyclopropyl)oxyimino-2-(2-methyl-1,3-dioxolan-2-yl)acetate?
ethyl (2Z)-2-(2,2-dibromocyclopropyl)oxyimino-2-(2-methyl-1,3-dioxolan-2-yl)acetate has a molecular weight of 401.05 g/mol, XLogP of 1.94, 5 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl (2Z)-2-(2,2-dibromocyclopropyl)oxyimino-2-(2-methyl-1,3-dioxolan-2-yl)acetate is sourced from PubChem (CID 14050529), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).