C24H23ClF6N2O4 — CID 140506936
ethyl (2R,4S)-4-[[3,5-bis(trifluoromethyl)phenyl]methyl-methoxycarbonylamino]-2-chloro-2-methyl-3,4-dihydroquinoline-1-carboxylate (PubChem CID 140506936) has the molecular formula C24H23ClF6N2O4 and a molecular weight of 552.90 g/mol. Its IUPAC name is ethyl (2R,4S)-4-[[3,5-bis(trifluoromethyl)phenyl]methyl-methoxycarbonylamino]-2-chloro-2-methyl-3,4-dihydroquinoline-1-carboxylate.
| Compound Name | ethyl (2R,4S)-4-[[3,5-bis(trifluoromethyl)phenyl]methyl-methoxycarbonylamino]-2-chloro-2-methyl-3,4-dihydroquinoline-1-carboxylate |
|---|---|
| PubChem CID | 140506936 |
| Molecular Formula | C24H23ClF6N2O4 |
| Molecular Weight | 552.90 g/mol |
| Exact Mass | 552.13 |
| IUPAC Name | ethyl (2R,4S)-4-[[3,5-bis(trifluoromethyl)phenyl]methyl-methoxycarbonylamino]-2-chloro-2-methyl-3,4-dihydroquinoline-1-carboxylate |
| SMILES | CCOC(=O)N1c2ccccc2[C@@H](N(Cc2cc(C(F)(F)F)cc(C(F)(F)F)c2)C(=O)OC)C[C@@]1(C)Cl |
| InChI | InChI=1S/C24H23ClF6N2O4/c1-4-37-21(35)33-18-8-6-5-7-17(18)19(12-22(33,2)25)32(20(34)36-3)13-14-9-15(23(26,27)28)11-16(10-14)24(29,30)31/h5-11,19H,4,12-13H2,1-3H3/t19-,22-/m0/s1 |
| InChIKey | GMIGCMINHDUSSB-UGKGYDQZSA-N |
| XLogP | 7.36 |
| TPSA | 59.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.90 |
| LogP ≤ 5 | 7.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|