C29H25ClF4N6O2 — CID 140507561
6-N-[(4-chloro-5-ethyl-2-fluorophenyl)-(2-methyl-5-phenyl-1,2,4-triazol-3-yl)methyl]isoquinoline-1,6-diamine;2,2,2-trifluoroacetic acid (PubChem CID 140507561) has the molecular formula C29H25ClF4N6O2 and a molecular weight of 601.00 g/mol. Its IUPAC name is 6-N-[(4-chloro-5-ethyl-2-fluorophenyl)-(2-methyl-5-phenyl-1,2,4-triazol-3-yl)methyl]isoquinoline-1,6-diamine;2,2,2-trifluoroacetic acid.
| Compound Name | 6-N-[(4-chloro-5-ethyl-2-fluorophenyl)-(2-methyl-5-phenyl-1,2,4-triazol-3-yl)methyl]isoquinoline-1,6-diamine;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 140507561 |
| Molecular Formula | C29H25ClF4N6O2 |
| Molecular Weight | 601.00 g/mol |
| Exact Mass | 600.17 |
| IUPAC Name | 6-N-[(4-chloro-5-ethyl-2-fluorophenyl)-(2-methyl-5-phenyl-1,2,4-triazol-3-yl)methyl]isoquinoline-1,6-diamine;2,2,2-trifluoroacetic acid |
| SMILES | CCc1cc(C(Nc2ccc3c(N)nccc3c2)c2nc(-c3ccccc3)nn2C)c(F)cc1Cl.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C27H24ClFN6.C2HF3O2/c1-3-16-14-21(23(29)15-22(16)28)24(27-33-26(34-35(27)2)17-7-5-4-6-8-17)32-19-9-10-20-18(13-19)11-12-31-25(20)30;3-2(4,5)1(6)7/h4-15,24,32H,3H2,1-2H3,(H2,30,31);(H,6,7) |
| InChIKey | VSDJBBMIHPBSGV-UHFFFAOYSA-N |
| XLogP | 6.80 |
| TPSA | 118.95 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 601.00 |
| LogP ≤ 5 | 6.80 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |