About 2-pyrrolidin-1-ylbenzoyl chloride
2-pyrrolidin-1-ylbenzoyl chloride (PubChem CID 140507858) has the molecular formula C11H12ClNO
and a molecular weight of 209.68 g/mol. Its IUPAC name is 2-pyrrolidin-1-ylbenzoyl chloride.
Molecular Properties
| Compound Name | 2-pyrrolidin-1-ylbenzoyl chloride |
| PubChem CID | 140507858 |
| Molecular Formula | C11H12ClNO |
| Molecular Weight | 209.68 g/mol |
| Exact Mass | 209.06 |
| IUPAC Name | 2-pyrrolidin-1-ylbenzoyl chloride |
| SMILES | O=C(Cl)c1ccccc1N1CCCC1 |
| InChI | InChI=1S/C11H12ClNO/c12-11(14)9-5-1-2-6-10(9)13-7-3-4-8-13/h1-2,5-6H,3-4,7-8H2 |
| InChIKey | SZQQEGNLOIUWJW-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 209.68 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'} |
|---|
Analyze 2-pyrrolidin-1-ylbenzoyl chloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-pyrrolidin-1-ylbenzoyl chloride?
The IUPAC name of 2-pyrrolidin-1-ylbenzoyl chloride (CID 140507858) is 2-pyrrolidin-1-ylbenzoyl chloride.
What is the SMILES notation for 2-pyrrolidin-1-ylbenzoyl chloride?
The canonical SMILES for 2-pyrrolidin-1-ylbenzoyl chloride is O=C(Cl)c1ccccc1N1CCCC1.
What is the InChIKey of 2-pyrrolidin-1-ylbenzoyl chloride?
The InChIKey is SZQQEGNLOIUWJW-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H12ClNO/c12-11(14)9-5-1-2-6-10(9)13-7-3-4-8-13/h1-2,5-6H,3-4,7-8H2.
What are the key properties of 2-pyrrolidin-1-ylbenzoyl chloride?
2-pyrrolidin-1-ylbenzoyl chloride has a molecular weight of 209.68 g/mol, XLogP of 2.67, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-pyrrolidin-1-ylbenzoyl chloride is sourced from PubChem (CID 140507858), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).