C35H30F5N5O6 — CID 140509203
[2-[8-(2,6-difluorophenyl)-2-(1,3-dihydroxypropan-2-ylamino)-7-oxopyrido[2,3-d]pyrimidin-4-yl]-3-methyl-6-(3-phenylpropylcarbamoyl)phenyl] 2,2,2-trifluoroacetate (PubChem CID 140509203) has the molecular formula C35H30F5N5O6 and a molecular weight of 711.64 g/mol. Its IUPAC name is [2-[8-(2,6-difluorophenyl)-2-(1,3-dihydroxypropan-2-ylamino)-7-oxopyrido[2,3-d]pyrimidin-4-yl]-3-methyl-6-(3-phenylpropylcarbamoyl)phenyl] 2,2,2-trifluoroacetate.
| Compound Name | [2-[8-(2,6-difluorophenyl)-2-(1,3-dihydroxypropan-2-ylamino)-7-oxopyrido[2,3-d]pyrimidin-4-yl]-3-methyl-6-(3-phenylpropylcarbamoyl)phenyl] 2,2,2-trifluoroacetate |
|---|---|
| PubChem CID | 140509203 |
| Molecular Formula | C35H30F5N5O6 |
| Molecular Weight | 711.64 g/mol |
| Exact Mass | 711.21 |
| IUPAC Name | [2-[8-(2,6-difluorophenyl)-2-(1,3-dihydroxypropan-2-ylamino)-7-oxopyrido[2,3-d]pyrimidin-4-yl]-3-methyl-6-(3-phenylpropylcarbamoyl)phenyl] 2,2,2-trifluoroacetate |
| SMILES | Cc1ccc(C(=O)NCCCc2ccccc2)c(OC(=O)C(F)(F)F)c1-c1nc(NC(CO)CO)nc2c1ccc(=O)n2-c1c(F)cccc1F |
| InChI | InChI=1S/C35H30F5N5O6/c1-19-12-13-23(32(49)41-16-6-9-20-7-3-2-4-8-20)30(51-33(50)35(38,39)40)27(19)28-22-14-15-26(48)45(29-24(36)10-5-11-25(29)37)31(22)44-34(43-28)42-21(17-46)18-47/h2-5,7-8,10-15,21,46-47H,6,9,16-18H2,1H3,(H,41,49)(H,42,43,44) |
| InChIKey | ILGSTWIYDMRKEZ-UHFFFAOYSA-N |
| XLogP | 4.63 |
| TPSA | 155.67 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 51 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 711.64 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|