C32H34F5N7O5 — CID 140509282
[2-[8-(2,6-difluorophenyl)-2-(3-morpholin-4-ylpropylamino)-7-oxo-5,6-dihydropyrimido[4,5-d]pyrimidin-4-yl]-3-methyl-6-(propan-2-ylcarbamoyl)phenyl] 2,2,2-trifluoroacetate (PubChem CID 140509282) has the molecular formula C32H34F5N7O5 and a molecular weight of 691.66 g/mol. Its IUPAC name is [2-[8-(2,6-difluorophenyl)-2-(3-morpholin-4-ylpropylamino)-7-oxo-5,6-dihydropyrimido[4,5-d]pyrimidin-4-yl]-3-methyl-6-(propan-2-ylcarbamoyl)phenyl] 2,2,2-trifluoroacetate.
| Compound Name | [2-[8-(2,6-difluorophenyl)-2-(3-morpholin-4-ylpropylamino)-7-oxo-5,6-dihydropyrimido[4,5-d]pyrimidin-4-yl]-3-methyl-6-(propan-2-ylcarbamoyl)phenyl] 2,2,2-trifluoroacetate |
|---|---|
| PubChem CID | 140509282 |
| Molecular Formula | C32H34F5N7O5 |
| Molecular Weight | 691.66 g/mol |
| Exact Mass | 691.25 |
| IUPAC Name | [2-[8-(2,6-difluorophenyl)-2-(3-morpholin-4-ylpropylamino)-7-oxo-5,6-dihydropyrimido[4,5-d]pyrimidin-4-yl]-3-methyl-6-(propan-2-ylcarbamoyl)phenyl] 2,2,2-trifluoroacetate |
| SMILES | Cc1ccc(C(=O)NC(C)C)c(OC(=O)C(F)(F)F)c1-c1nc(NCCCN2CCOCC2)nc2c1CNC(=O)N2c1c(F)cccc1F |
| InChI | InChI=1S/C32H34F5N7O5/c1-17(2)40-28(45)19-9-8-18(3)23(26(19)49-29(46)32(35,36)37)24-20-16-39-31(47)44(25-21(33)6-4-7-22(25)34)27(20)42-30(41-24)38-10-5-11-43-12-14-48-15-13-43/h4,6-9,17H,5,10-16H2,1-3H3,(H,39,47)(H,40,45)(H,38,41,42) |
| InChIKey | KNEPGDXMBJTAHG-UHFFFAOYSA-N |
| XLogP | 4.83 |
| TPSA | 138.02 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 49 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 691.66 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|