C14H11Cl2F6N5OS — CID 140509425
1-[2,6-dichloro-4-(trifluoromethyl)phenyl]-N-hydroxy-N'-methyl-5-(methylamino)-4-(trifluoromethylsulfanyl)pyrazole-3-carboximidamide (PubChem CID 140509425) has the molecular formula C14H11Cl2F6N5OS and a molecular weight of 482.24 g/mol. Its IUPAC name is 1-[2,6-dichloro-4-(trifluoromethyl)phenyl]-N-hydroxy-N'-methyl-5-(methylamino)-4-(trifluoromethylsulfanyl)pyrazole-3-carboximidamide.
| Compound Name | 1-[2,6-dichloro-4-(trifluoromethyl)phenyl]-N-hydroxy-N'-methyl-5-(methylamino)-4-(trifluoromethylsulfanyl)pyrazole-3-carboximidamide |
|---|---|
| PubChem CID | 140509425 |
| Molecular Formula | C14H11Cl2F6N5OS |
| Molecular Weight | 482.24 g/mol |
| Exact Mass | 481.00 |
| IUPAC Name | 1-[2,6-dichloro-4-(trifluoromethyl)phenyl]-N-hydroxy-N'-methyl-5-(methylamino)-4-(trifluoromethylsulfanyl)pyrazole-3-carboximidamide |
| SMILES | C/N=C(\NO)c1nn(-c2c(Cl)cc(C(F)(F)F)cc2Cl)c(NC)c1SC(F)(F)F |
| InChI | InChI=1S/C14H11Cl2F6N5OS/c1-23-11(26-28)8-10(29-14(20,21)22)12(24-2)27(25-8)9-6(15)3-5(4-7(9)16)13(17,18)19/h3-4,24,28H,1-2H3,(H,23,26) |
| InChIKey | USDBUKSPJFGQFJ-UHFFFAOYSA-N |
| XLogP | 5.21 |
| TPSA | 74.47 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.24 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|