C15H15F3N2O2 — CID 140509455
3-methyl-5-propan-2-yl-2-[4-(trifluoromethyl)phenyl]imidazole-4-carboxylic acid (PubChem CID 140509455) has the molecular formula C15H15F3N2O2 and a molecular weight of 312.29 g/mol. Its IUPAC name is 3-methyl-5-propan-2-yl-2-[4-(trifluoromethyl)phenyl]imidazole-4-carboxylic acid.
| Compound Name | 3-methyl-5-propan-2-yl-2-[4-(trifluoromethyl)phenyl]imidazole-4-carboxylic acid |
|---|---|
| PubChem CID | 140509455 |
| Molecular Formula | C15H15F3N2O2 |
| Molecular Weight | 312.29 g/mol |
| Exact Mass | 312.11 |
| IUPAC Name | 3-methyl-5-propan-2-yl-2-[4-(trifluoromethyl)phenyl]imidazole-4-carboxylic acid |
| SMILES | CC(C)c1nc(-c2ccc(C(F)(F)F)cc2)n(C)c1C(=O)O |
| InChI | InChI=1S/C15H15F3N2O2/c1-8(2)11-12(14(21)22)20(3)13(19-11)9-4-6-10(7-5-9)15(16,17)18/h4-8H,1-3H3,(H,21,22) |
| InChIKey | LUCWZFYEAICUBS-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.29 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |