C10H16FNO — CID 140510061
7-fluoro-3,3-dimethyl-3a,4,5,6,7,7a-hexahydro-1H-indol-2-one (PubChem CID 140510061) has the molecular formula C10H16FNO and a molecular weight of 185.24 g/mol. Its IUPAC name is 7-fluoro-3,3-dimethyl-3a,4,5,6,7,7a-hexahydro-1H-indol-2-one.
| Compound Name | 7-fluoro-3,3-dimethyl-3a,4,5,6,7,7a-hexahydro-1H-indol-2-one |
|---|---|
| PubChem CID | 140510061 |
| Molecular Formula | C10H16FNO |
| Molecular Weight | 185.24 g/mol |
| Exact Mass | 185.12 |
| IUPAC Name | 7-fluoro-3,3-dimethyl-3a,4,5,6,7,7a-hexahydro-1H-indol-2-one |
| SMILES | CC1(C)C(=O)NC2C(F)CCCC21 |
| InChI | InChI=1S/C10H16FNO/c1-10(2)6-4-3-5-7(11)8(6)12-9(10)13/h6-8H,3-5H2,1-2H3,(H,12,13) |
| InChIKey | BRLXVVGETSMVJV-UHFFFAOYSA-N |
| XLogP | 1.65 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 185.24 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |