C17H16FN3O2S — CID 140510144
3-[5-(4-fluorophenyl)-4-pyridin-4-ylimidazol-1-yl]-2-sulfanylpropane-1,2-diol (PubChem CID 140510144) has the molecular formula C17H16FN3O2S and a molecular weight of 345.40 g/mol. Its IUPAC name is 3-[5-(4-fluorophenyl)-4-pyridin-4-ylimidazol-1-yl]-2-sulfanylpropane-1,2-diol.
| Compound Name | 3-[5-(4-fluorophenyl)-4-pyridin-4-ylimidazol-1-yl]-2-sulfanylpropane-1,2-diol |
|---|---|
| PubChem CID | 140510144 |
| Molecular Formula | C17H16FN3O2S |
| Molecular Weight | 345.40 g/mol |
| Exact Mass | 345.09 |
| IUPAC Name | 3-[5-(4-fluorophenyl)-4-pyridin-4-ylimidazol-1-yl]-2-sulfanylpropane-1,2-diol |
| SMILES | OCC(O)(S)Cn1cnc(-c2ccncc2)c1-c1ccc(F)cc1 |
| InChI | InChI=1S/C17H16FN3O2S/c18-14-3-1-13(2-4-14)16-15(12-5-7-19-8-6-12)20-11-21(16)9-17(23,24)10-22/h1-8,11,22-24H,9-10H2 |
| InChIKey | BLPSJUPJOGMMBT-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 71.17 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.40 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|